C19H23ClN3O3S+ — CID 8531298
4-[(4-chlorophenyl)sulfamoyl]-N-(2-pyrrolidin-1-ium-1-ylethyl)benzamide (PubChem CID 8531298) has the molecular formula C19H23ClN3O3S+ and a molecular weight of 408.93 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfamoyl]-N-(2-pyrrolidin-1-ium-1-ylethyl)benzamide.
| Compound Name | 4-[(4-chlorophenyl)sulfamoyl]-N-(2-pyrrolidin-1-ium-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 8531298 |
| Molecular Formula | C19H23ClN3O3S+ |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfamoyl]-N-(2-pyrrolidin-1-ium-1-ylethyl)benzamide |
| SMILES | O=C(NCC[NH+]1CCCC1)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C19H22ClN3O3S/c20-16-5-7-17(8-6-16)22-27(25,26)18-9-3-15(4-10-18)19(24)21-11-14-23-12-1-2-13-23/h3-10,22H,1-2,11-14H2,(H,21,24)/p+1 |
| InChIKey | PQKJPGMKAAAGED-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |