C20H27ClN3O3S+ — CID 9089870
tert-butyl-[3-[[4-[(4-chlorophenyl)sulfamoyl]benzoyl]amino]propyl]azanium (PubChem CID 9089870) has the molecular formula C20H27ClN3O3S+ and a molecular weight of 424.97 g/mol. Its IUPAC name is tert-butyl-[3-[[4-[(4-chlorophenyl)sulfamoyl]benzoyl]amino]propyl]azanium.
| Compound Name | tert-butyl-[3-[[4-[(4-chlorophenyl)sulfamoyl]benzoyl]amino]propyl]azanium |
|---|---|
| PubChem CID | 9089870 |
| Molecular Formula | C20H27ClN3O3S+ |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | tert-butyl-[3-[[4-[(4-chlorophenyl)sulfamoyl]benzoyl]amino]propyl]azanium |
| SMILES | CC(C)(C)[NH2+]CCCNC(=O)c1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C20H26ClN3O3S/c1-20(2,3)23-14-4-13-22-19(25)15-5-11-18(12-6-15)28(26,27)24-17-9-7-16(21)8-10-17/h5-12,23-24H,4,13-14H2,1-3H3,(H,22,25)/p+1 |
| InChIKey | UMNWAYIOZHQWDH-UHFFFAOYSA-O |
| XLogP | 2.62 |
| TPSA | 91.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|