C16H23N6O2S2+ — CID 8562705
1-[[2-(1,3-benzothiazol-2-ylamino)acetyl]amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea (PubChem CID 8562705) has the molecular formula C16H23N6O2S2+ and a molecular weight of 395.53 g/mol. Its IUPAC name is 1-[[2-(1,3-benzothiazol-2-ylamino)acetyl]amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea.
| Compound Name | 1-[[2-(1,3-benzothiazol-2-ylamino)acetyl]amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8562705 |
| Molecular Formula | C16H23N6O2S2+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 1-[[2-(1,3-benzothiazol-2-ylamino)acetyl]amino]-3-(2-morpholin-4-ium-4-ylethyl)thiourea |
| SMILES | O=C(CNc1nc2ccccc2s1)NNC(=S)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C16H22N6O2S2/c23-14(11-18-16-19-12-3-1-2-4-13(12)26-16)20-21-15(25)17-5-6-22-7-9-24-10-8-22/h1-4H,5-11H2,(H,18,19)(H,20,23)(H2,17,21,25)/p+1 |
| InChIKey | MHACICOXFHYKJF-UHFFFAOYSA-O |
| XLogP | -0.88 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|