C19H16N6O2S — CID 24684526
N'-[2-(1,3-benzothiazol-2-ylamino)acetyl]-5-phenyl-1H-pyrazole-4-carbohydrazide (PubChem CID 24684526) has the molecular formula C19H16N6O2S and a molecular weight of 392.44 g/mol. Its IUPAC name is N'-[2-(1,3-benzothiazol-2-ylamino)acetyl]-5-phenyl-1H-pyrazole-4-carbohydrazide.
| Compound Name | N'-[2-(1,3-benzothiazol-2-ylamino)acetyl]-5-phenyl-1H-pyrazole-4-carbohydrazide |
|---|---|
| PubChem CID | 24684526 |
| Molecular Formula | C19H16N6O2S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | N'-[2-(1,3-benzothiazol-2-ylamino)acetyl]-5-phenyl-1H-pyrazole-4-carbohydrazide |
| SMILES | O=C(CNc1nc2ccccc2s1)NNC(=O)c1cn[nH]c1-c1ccccc1 |
| InChI | InChI=1S/C19H16N6O2S/c26-16(11-20-19-22-14-8-4-5-9-15(14)28-19)23-25-18(27)13-10-21-24-17(13)12-6-2-1-3-7-12/h1-10H,11H2,(H,20,22)(H,21,24)(H,23,26)(H,25,27) |
| InChIKey | FDKCWAYWGMJBDK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|