C17H14Cl2N4O3S — CID 16580030
N'-[2-(1,3-benzothiazol-2-ylamino)acetyl]-3,5-dichloro-4-methoxybenzohydrazide (PubChem CID 16580030) has the molecular formula C17H14Cl2N4O3S and a molecular weight of 425.30 g/mol. Its IUPAC name is N'-[2-(1,3-benzothiazol-2-ylamino)acetyl]-3,5-dichloro-4-methoxybenzohydrazide.
| Compound Name | N'-[2-(1,3-benzothiazol-2-ylamino)acetyl]-3,5-dichloro-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 16580030 |
| Molecular Formula | C17H14Cl2N4O3S |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 424.02 |
| IUPAC Name | N'-[2-(1,3-benzothiazol-2-ylamino)acetyl]-3,5-dichloro-4-methoxybenzohydrazide |
| SMILES | COc1c(Cl)cc(C(=O)NNC(=O)CNc2nc3ccccc3s2)cc1Cl |
| InChI | InChI=1S/C17H14Cl2N4O3S/c1-26-15-10(18)6-9(7-11(15)19)16(25)23-22-14(24)8-20-17-21-12-4-2-3-5-13(12)27-17/h2-7H,8H2,1H3,(H,20,21)(H,22,24)(H,23,25) |
| InChIKey | BHWZGTMVWWYDQK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|