C22H21N7O3S2 — CID 16601186
N-[4-[[[2-(1,3-benzothiazol-2-ylamino)acetyl]amino]carbamoyl]phenyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide (PubChem CID 16601186) has the molecular formula C22H21N7O3S2 and a molecular weight of 495.59 g/mol. Its IUPAC name is N-[4-[[[2-(1,3-benzothiazol-2-ylamino)acetyl]amino]carbamoyl]phenyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[4-[[[2-(1,3-benzothiazol-2-ylamino)acetyl]amino]carbamoyl]phenyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 16601186 |
| Molecular Formula | C22H21N7O3S2 |
| Molecular Weight | 495.59 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | N-[4-[[[2-(1,3-benzothiazol-2-ylamino)acetyl]amino]carbamoyl]phenyl]-2-(1-methylimidazol-2-yl)sulfanylacetamide |
| SMILES | Cn1ccnc1SCC(=O)Nc1ccc(C(=O)NNC(=O)CNc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C22H21N7O3S2/c1-29-11-10-23-22(29)33-13-19(31)25-15-8-6-14(7-9-15)20(32)28-27-18(30)12-24-21-26-16-4-2-3-5-17(16)34-21/h2-11H,12-13H2,1H3,(H,24,26)(H,25,31)(H,27,30)(H,28,32) |
| InChIKey | HNHPKKQHQHEEHS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 130.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.59 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|