C21H21N5O3S — CID 24620396
N-methyl-3-[[4-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]benzoyl]amino]benzamide (PubChem CID 24620396) has the molecular formula C21H21N5O3S and a molecular weight of 423.50 g/mol. Its IUPAC name is N-methyl-3-[[4-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]benzoyl]amino]benzamide.
| Compound Name | N-methyl-3-[[4-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 24620396 |
| Molecular Formula | C21H21N5O3S |
| Molecular Weight | 423.50 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | N-methyl-3-[[4-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]benzoyl]amino]benzamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2ccc(NC(=O)CSc3nccn3C)cc2)c1 |
| InChI | InChI=1S/C21H21N5O3S/c1-22-19(28)15-4-3-5-17(12-15)25-20(29)14-6-8-16(9-7-14)24-18(27)13-30-21-23-10-11-26(21)2/h3-12H,13H2,1-2H3,(H,22,28)(H,24,27)(H,25,29) |
| InChIKey | HYHBMENJVYKLSE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 105.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.50 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |