C15H18N4O2S — CID 9200888
N-ethyl-3-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]benzamide (PubChem CID 9200888) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-ethyl-3-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]benzamide.
| Compound Name | N-ethyl-3-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 9200888 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-ethyl-3-[[2-(1-methylimidazol-2-yl)sulfanylacetyl]amino]benzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)CSc2nccn2C)c1 |
| InChI | InChI=1S/C15H18N4O2S/c1-3-16-14(21)11-5-4-6-12(9-11)18-13(20)10-22-15-17-7-8-19(15)2/h4-9H,3,10H2,1-2H3,(H,16,21)(H,18,20) |
| InChIKey | AEXRCZYWQQFBLI-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |