C17H16N4O2S2 — CID 17418273
N-ethyl-3-[(2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetyl)amino]benzamide (PubChem CID 17418273) has the molecular formula C17H16N4O2S2 and a molecular weight of 372.48 g/mol. Its IUPAC name is N-ethyl-3-[(2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetyl)amino]benzamide.
| Compound Name | N-ethyl-3-[(2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetyl)amino]benzamide |
|---|---|
| PubChem CID | 17418273 |
| Molecular Formula | C17H16N4O2S2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | N-ethyl-3-[(2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetyl)amino]benzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)CSc2ncnc3ccsc23)c1 |
| InChI | InChI=1S/C17H16N4O2S2/c1-2-18-16(23)11-4-3-5-12(8-11)21-14(22)9-25-17-15-13(6-7-24-15)19-10-20-17/h3-8,10H,2,9H2,1H3,(H,18,23)(H,21,22) |
| InChIKey | JGYRYIKSHKSHHF-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |