C14H10BrN3OS2 — CID 34244719
N-(3-bromophenyl)-2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetamide (PubChem CID 34244719) has the molecular formula C14H10BrN3OS2 and a molecular weight of 380.29 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetamide.
| Compound Name | N-(3-bromophenyl)-2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 34244719 |
| Molecular Formula | C14H10BrN3OS2 |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 378.94 |
| IUPAC Name | N-(3-bromophenyl)-2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetamide |
| SMILES | O=C(CSc1ncnc2ccsc12)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C14H10BrN3OS2/c15-9-2-1-3-10(6-9)18-12(19)7-21-14-13-11(4-5-20-13)16-8-17-14/h1-6,8H,7H2,(H,18,19) |
| InChIKey | DBSNIPPOZJURSJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |