C12H15N3O2S2 — CID 46661847
N-(3-methoxypropyl)-2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetamide (PubChem CID 46661847) has the molecular formula C12H15N3O2S2 and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(3-methoxypropyl)-2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetamide.
| Compound Name | N-(3-methoxypropyl)-2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetamide |
|---|---|
| PubChem CID | 46661847 |
| Molecular Formula | C12H15N3O2S2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-(3-methoxypropyl)-2-thieno[3,2-d]pyrimidin-4-ylsulfanylacetamide |
| SMILES | COCCCNC(=O)CSc1ncnc2ccsc12 |
| InChI | InChI=1S/C12H15N3O2S2/c1-17-5-2-4-13-10(16)7-19-12-11-9(3-6-18-11)14-8-15-12/h3,6,8H,2,4-5,7H2,1H3,(H,13,16) |
| InChIKey | MWZKLWJDHPCIFU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|