C14H20N4O4S — CID 8684647
2-(3-morpholin-4-ium-4-ylpropylcarbamothioylamino)-4-nitrophenolate (PubChem CID 8684647) has the molecular formula C14H20N4O4S and a molecular weight of 340.41 g/mol. Its IUPAC name is 2-(3-morpholin-4-ium-4-ylpropylcarbamothioylamino)-4-nitrophenolate.
| Compound Name | 2-(3-morpholin-4-ium-4-ylpropylcarbamothioylamino)-4-nitrophenolate |
|---|---|
| PubChem CID | 8684647 |
| Molecular Formula | C14H20N4O4S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 2-(3-morpholin-4-ium-4-ylpropylcarbamothioylamino)-4-nitrophenolate |
| SMILES | O=[N+]([O-])c1ccc([O-])c(NC(=S)NCCC[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C14H20N4O4S/c19-13-3-2-11(18(20)21)10-12(13)16-14(23)15-4-1-5-17-6-8-22-9-7-17/h2-3,10,19H,1,4-9H2,(H2,15,16,23) |
| InChIKey | MRUZMOJBOBMNQC-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|