C12H20N4O3+2 — CID 7446284
N-(3-morpholin-4-ium-4-ylpropyl)-5-nitropyridin-1-ium-2-amine (PubChem CID 7446284) has the molecular formula C12H20N4O3+2 and a molecular weight of 268.32 g/mol. Its IUPAC name is N-(3-morpholin-4-ium-4-ylpropyl)-5-nitropyridin-1-ium-2-amine.
| Compound Name | N-(3-morpholin-4-ium-4-ylpropyl)-5-nitropyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 7446284 |
| Molecular Formula | C12H20N4O3+2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | N-(3-morpholin-4-ium-4-ylpropyl)-5-nitropyridin-1-ium-2-amine |
| SMILES | O=[N+]([O-])c1ccc(NCCC[NH+]2CCOCC2)[nH+]c1 |
| InChI | InChI=1S/C12H18N4O3/c17-16(18)11-2-3-12(14-10-11)13-4-1-5-15-6-8-19-9-7-15/h2-3,10H,1,4-9H2,(H,13,14)/p+2 |
| InChIKey | CSYAEPYKNUNJLE-UHFFFAOYSA-P |
| XLogP | -0.87 |
| TPSA | 82.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|