C19H18F2N4O3S2 — CID 51559695
1-[4-(difluoromethylsulfanyl)phenyl]-3-[(4S)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]thiourea (PubChem CID 51559695) has the molecular formula C19H18F2N4O3S2 and a molecular weight of 452.51 g/mol. Its IUPAC name is 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(4S)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]thiourea.
| Compound Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(4S)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]thiourea |
|---|---|
| PubChem CID | 51559695 |
| Molecular Formula | C19H18F2N4O3S2 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 1-[4-(difluoromethylsulfanyl)phenyl]-3-[(4S)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]thiourea |
| SMILES | COc1ccc([C@]2(C)NC(=O)N(NC(=S)Nc3ccc(SC(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C19H18F2N4O3S2/c1-19(11-3-7-13(28-2)8-4-11)15(26)25(18(27)23-19)24-17(29)22-12-5-9-14(10-6-12)30-16(20)21/h3-10,16H,1-2H3,(H,23,27)(H2,22,24,29)/t19-/m0/s1 |
| InChIKey | WQRBOGXBPOLVIT-IBGZPJMESA-N |
| XLogP | 3.68 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|