C17H22N4O3S — CID 8683796
1-(4-methoxyphenyl)-3-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)thiourea (PubChem CID 8683796) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)thiourea |
|---|---|
| PubChem CID | 8683796 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)thiourea |
| SMILES | COc1ccc(NC(=S)NN2C(=O)NC3(CCC(C)CC3)C2=O)cc1 |
| InChI | InChI=1S/C17H22N4O3S/c1-11-7-9-17(10-8-11)14(22)21(16(23)19-17)20-15(25)18-12-3-5-13(24-2)6-4-12/h3-6,11H,7-10H2,1-2H3,(H,19,23)(H2,18,20,25) |
| InChIKey | OBJVONIPQKXKMO-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|