C24H32N4O6 — CID 55719853
1-(3,5-dimethoxybenzoyl)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)piperidine-4-carboxamide (PubChem CID 55719853) has the molecular formula C24H32N4O6 and a molecular weight of 472.54 g/mol. Its IUPAC name is 1-(3,5-dimethoxybenzoyl)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)piperidine-4-carboxamide.
| Compound Name | 1-(3,5-dimethoxybenzoyl)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55719853 |
| Molecular Formula | C24H32N4O6 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | 1-(3,5-dimethoxybenzoyl)-N-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)piperidine-4-carboxamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(C(=O)NN3C(=O)NC4(CCC(C)CC4)C3=O)CC2)c1 |
| InChI | InChI=1S/C24H32N4O6/c1-15-4-8-24(9-5-15)22(31)28(23(32)25-24)26-20(29)16-6-10-27(11-7-16)21(30)17-12-18(33-2)14-19(13-17)34-3/h12-16H,4-11H2,1-3H3,(H,25,32)(H,26,29) |
| InChIKey | GTLPXMLTNWIDIZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|