C25H34N2O4 — CID 78884210
N-(2-adamantyl)-1-(3,5-dimethoxybenzoyl)piperidine-4-carboxamide (PubChem CID 78884210) has the molecular formula C25H34N2O4 and a molecular weight of 426.56 g/mol. Its IUPAC name is N-(2-adamantyl)-1-(3,5-dimethoxybenzoyl)piperidine-4-carboxamide.
| Compound Name | N-(2-adamantyl)-1-(3,5-dimethoxybenzoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 78884210 |
| Molecular Formula | C25H34N2O4 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.25 |
| IUPAC Name | N-(2-adamantyl)-1-(3,5-dimethoxybenzoyl)piperidine-4-carboxamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(C(=O)NC3C4CC5CC(C4)CC3C5)CC2)c1 |
| InChI | InChI=1S/C25H34N2O4/c1-30-21-12-20(13-22(14-21)31-2)25(29)27-5-3-17(4-6-27)24(28)26-23-18-8-15-7-16(10-18)11-19(23)9-15/h12-19,23H,3-11H2,1-2H3,(H,26,28) |
| InChIKey | XXWSWGDBFXIBGX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |