C26H37N3O4 — CID 24951842
4-N-(2-adamantyl)-1-N-[(2,4-dimethoxyphenyl)methyl]piperidine-1,4-dicarboxamide (PubChem CID 24951842) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is 4-N-(2-adamantyl)-1-N-[(2,4-dimethoxyphenyl)methyl]piperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(2-adamantyl)-1-N-[(2,4-dimethoxyphenyl)methyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 24951842 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 4-N-(2-adamantyl)-1-N-[(2,4-dimethoxyphenyl)methyl]piperidine-1,4-dicarboxamide |
| SMILES | COc1ccc(CNC(=O)N2CCC(C(=O)NC3C4CC5CC(C4)CC3C5)CC2)c(OC)c1 |
| InChI | InChI=1S/C26H37N3O4/c1-32-22-4-3-19(23(14-22)33-2)15-27-26(31)29-7-5-18(6-8-29)25(30)28-24-20-10-16-9-17(12-20)13-21(24)11-16/h3-4,14,16-18,20-21,24H,5-13,15H2,1-2H3,(H,27,31)(H,28,30) |
| InChIKey | WLIYGROUDAFDBF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |