C12H15N5O2S — CID 141494861
1-(4-methoxyphenyl)-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)thiourea (PubChem CID 141494861) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)thiourea.
| Compound Name | 1-(4-methoxyphenyl)-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)thiourea |
|---|---|
| PubChem CID | 141494861 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)thiourea |
| SMILES | COc1ccc(NC(=S)NN2CC(C)=NNC2=O)cc1 |
| InChI | InChI=1S/C12H15N5O2S/c1-8-7-17(12(18)15-14-8)16-11(20)13-9-3-5-10(19-2)6-4-9/h3-6H,7H2,1-2H3,(H,15,18)(H2,13,16,20) |
| InChIKey | RGKKFQNZNWZYME-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|