C11H12IN5O2 — CID 141494834
1-(4-iodophenyl)-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)urea (PubChem CID 141494834) has the molecular formula C11H12IN5O2 and a molecular weight of 373.15 g/mol. Its IUPAC name is 1-(4-iodophenyl)-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)urea.
| Compound Name | 1-(4-iodophenyl)-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)urea |
|---|---|
| PubChem CID | 141494834 |
| Molecular Formula | C11H12IN5O2 |
| Molecular Weight | 373.15 g/mol |
| Exact Mass | 373.00 |
| IUPAC Name | 1-(4-iodophenyl)-3-(6-methyl-3-oxo-2,5-dihydro-1,2,4-triazin-4-yl)urea |
| SMILES | CC1=NNC(=O)N(NC(=O)Nc2ccc(I)cc2)C1 |
| InChI | InChI=1S/C11H12IN5O2/c1-7-6-17(11(19)15-14-7)16-10(18)13-9-4-2-8(12)3-5-9/h2-5H,6H2,1H3,(H,15,19)(H2,13,16,18) |
| InChIKey | HLFDSRIYBNGPBZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.15 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|