C12H13BrN4O3 — CID 75453174
1-(3-bromo-4-methylphenyl)-3-(3-methyl-2,4-dioxoimidazolidin-1-yl)urea (PubChem CID 75453174) has the molecular formula C12H13BrN4O3 and a molecular weight of 341.17 g/mol. Its IUPAC name is 1-(3-bromo-4-methylphenyl)-3-(3-methyl-2,4-dioxoimidazolidin-1-yl)urea.
| Compound Name | 1-(3-bromo-4-methylphenyl)-3-(3-methyl-2,4-dioxoimidazolidin-1-yl)urea |
|---|---|
| PubChem CID | 75453174 |
| Molecular Formula | C12H13BrN4O3 |
| Molecular Weight | 341.17 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 1-(3-bromo-4-methylphenyl)-3-(3-methyl-2,4-dioxoimidazolidin-1-yl)urea |
| SMILES | Cc1ccc(NC(=O)NN2CC(=O)N(C)C2=O)cc1Br |
| InChI | InChI=1S/C12H13BrN4O3/c1-7-3-4-8(5-9(7)13)14-11(19)15-17-6-10(18)16(2)12(17)20/h3-5H,6H2,1-2H3,(H2,14,15,19) |
| InChIKey | XTLRINUZNFKXJQ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.17 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|