C17H14ClFN4O2S — CID 8766602
1-(3-chloro-4-fluorophenyl)-3-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]thiourea (PubChem CID 8766602) has the molecular formula C17H14ClFN4O2S and a molecular weight of 392.84 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]thiourea |
|---|---|
| PubChem CID | 8766602 |
| Molecular Formula | C17H14ClFN4O2S |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[(4S)-4-methyl-2,5-dioxo-4-phenylimidazolidin-1-yl]thiourea |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)N(NC(=S)Nc2ccc(F)c(Cl)c2)C1=O |
| InChI | InChI=1S/C17H14ClFN4O2S/c1-17(10-5-3-2-4-6-10)14(24)23(16(25)21-17)22-15(26)20-11-7-8-13(19)12(18)9-11/h2-9H,1H3,(H,21,25)(H2,20,22,26)/t17-/m0/s1 |
| InChIKey | RMYWTAOFALEAAJ-KRWDZBQOSA-N |
| XLogP | 3.15 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|