C17H22N4O4S — CID 8766809
1-[(4R)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 8766809) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 1-[(4R)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(4R)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 8766809 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-[(4R)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | COc1ccc([C@@]2(C)NC(=O)N(NC(=S)NC[C@@H]3CCCO3)C2=O)cc1 |
| InChI | InChI=1S/C17H22N4O4S/c1-17(11-5-7-12(24-2)8-6-11)14(22)21(16(23)19-17)20-15(26)18-10-13-4-3-9-25-13/h5-8,13H,3-4,9-10H2,1-2H3,(H,19,23)(H2,18,20,26)/t13-,17+/m0/s1 |
| InChIKey | DRTHXUDZEXRMCT-SUMWQHHRSA-N |
| XLogP | 1.02 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|