C20H20F2N4O4S — CID 41100755
1-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-(4-ethoxyphenyl)thiourea (PubChem CID 41100755) has the molecular formula C20H20F2N4O4S and a molecular weight of 450.47 g/mol. Its IUPAC name is 1-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-(4-ethoxyphenyl)thiourea.
| Compound Name | 1-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-(4-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 41100755 |
| Molecular Formula | C20H20F2N4O4S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 1-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-3-(4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)NN2C(=O)N[C@](C)(c3ccc(OC(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C20H20F2N4O4S/c1-3-29-14-10-6-13(7-11-14)23-18(31)25-26-16(27)20(2,24-19(26)28)12-4-8-15(9-5-12)30-17(21)22/h4-11,17H,3H2,1-2H3,(H,24,28)(H2,23,25,31)/t20-/m1/s1 |
| InChIKey | QFHTYJFCLBAYNI-HXUWFJFHSA-N |
| XLogP | 3.36 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|