C17H17N5O4S — CID 42927432
N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-pyrimidin-2-ylsulfanylacetamide (PubChem CID 42927432) has the molecular formula C17H17N5O4S and a molecular weight of 387.42 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-pyrimidin-2-ylsulfanylacetamide.
| Compound Name | N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-pyrimidin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 42927432 |
| Molecular Formula | C17H17N5O4S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-pyrimidin-2-ylsulfanylacetamide |
| SMILES | COc1ccc(C2(C)NC(=O)N(NC(=O)CSc3ncccn3)C2=O)cc1 |
| InChI | InChI=1S/C17H17N5O4S/c1-17(11-4-6-12(26-2)7-5-11)14(24)22(16(25)20-17)21-13(23)10-27-15-18-8-3-9-19-15/h3-9H,10H2,1-2H3,(H,20,25)(H,21,23) |
| InChIKey | QDLLNDNFKYLYCF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 113.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|