C19H23N5O4S — CID 41472125
N-[(4S)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-(1-propylimidazol-2-yl)sulfanylacetamide (PubChem CID 41472125) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is N-[(4S)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-(1-propylimidazol-2-yl)sulfanylacetamide.
| Compound Name | N-[(4S)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-(1-propylimidazol-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 41472125 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[(4S)-4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-(1-propylimidazol-2-yl)sulfanylacetamide |
| SMILES | CCCn1ccnc1SCC(=O)NN1C(=O)N[C@@](C)(c2ccc(OC)cc2)C1=O |
| InChI | InChI=1S/C19H23N5O4S/c1-4-10-23-11-9-20-18(23)29-12-15(25)22-24-16(26)19(2,21-17(24)27)13-5-7-14(28-3)8-6-13/h5-9,11H,4,10,12H2,1-3H3,(H,21,27)(H,22,25)/t19-/m0/s1 |
| InChIKey | NMGJKWUGEHMXLE-IBGZPJMESA-N |
| XLogP | 1.89 |
| TPSA | 105.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|