C25H25N5O4 — CID 55446432
N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-[[phenyl(pyridin-2-yl)methyl]amino]acetamide (PubChem CID 55446432) has the molecular formula C25H25N5O4 and a molecular weight of 459.51 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-[[phenyl(pyridin-2-yl)methyl]amino]acetamide.
| Compound Name | N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-[[phenyl(pyridin-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 55446432 |
| Molecular Formula | C25H25N5O4 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-[[phenyl(pyridin-2-yl)methyl]amino]acetamide |
| SMILES | COc1ccc(C2(C)NC(=O)N(NC(=O)CNC(c3ccccc3)c3ccccn3)C2=O)cc1 |
| InChI | InChI=1S/C25H25N5O4/c1-25(18-11-13-19(34-2)14-12-18)23(32)30(24(33)28-25)29-21(31)16-27-22(17-8-4-3-5-9-17)20-10-6-7-15-26-20/h3-15,22,27H,16H2,1-2H3,(H,28,33)(H,29,31) |
| InChIKey | JINRTEUREGNIMR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|