C24H30N4O5 — CID 55869110
N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-[methyl-[3-(2-methylphenoxy)propyl]amino]acetamide (PubChem CID 55869110) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-[methyl-[3-(2-methylphenoxy)propyl]amino]acetamide.
| Compound Name | N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-[methyl-[3-(2-methylphenoxy)propyl]amino]acetamide |
|---|---|
| PubChem CID | 55869110 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | N-[4-(4-methoxyphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-2-[methyl-[3-(2-methylphenoxy)propyl]amino]acetamide |
| SMILES | COc1ccc(C2(C)NC(=O)N(NC(=O)CN(C)CCCOc3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C24H30N4O5/c1-17-8-5-6-9-20(17)33-15-7-14-27(3)16-21(29)26-28-22(30)24(2,25-23(28)31)18-10-12-19(32-4)13-11-18/h5-6,8-13H,7,14-16H2,1-4H3,(H,25,31)(H,26,29) |
| InChIKey | UQYOXFUZZYGAJP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|