C21H28N2O3 — CID 60507219
N-[(3-methoxyphenyl)methyl]-2-[methyl-[3-(2-methylphenoxy)propyl]amino]acetamide (PubChem CID 60507219) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[(3-methoxyphenyl)methyl]-2-[methyl-[3-(2-methylphenoxy)propyl]amino]acetamide.
| Compound Name | N-[(3-methoxyphenyl)methyl]-2-[methyl-[3-(2-methylphenoxy)propyl]amino]acetamide |
|---|---|
| PubChem CID | 60507219 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-[(3-methoxyphenyl)methyl]-2-[methyl-[3-(2-methylphenoxy)propyl]amino]acetamide |
| SMILES | COc1cccc(CNC(=O)CN(C)CCCOc2ccccc2C)c1 |
| InChI | InChI=1S/C21H28N2O3/c1-17-8-4-5-11-20(17)26-13-7-12-23(2)16-21(24)22-15-18-9-6-10-19(14-18)25-3/h4-6,8-11,14H,7,12-13,15-16H2,1-3H3,(H,22,24) |
| InChIKey | NFQAENKLBTXJKO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|