C21H26N2O6 — CID 24761813
2-[(3-methoxyphenyl)methyl-methylamino]-N-[(4-methylphenyl)methyl]acetamide;oxalic acid (PubChem CID 24761813) has the molecular formula C21H26N2O6 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methyl-methylamino]-N-[(4-methylphenyl)methyl]acetamide;oxalic acid.
| Compound Name | 2-[(3-methoxyphenyl)methyl-methylamino]-N-[(4-methylphenyl)methyl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 24761813 |
| Molecular Formula | C21H26N2O6 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 2-[(3-methoxyphenyl)methyl-methylamino]-N-[(4-methylphenyl)methyl]acetamide;oxalic acid |
| SMILES | COc1cccc(CN(C)CC(=O)NCc2ccc(C)cc2)c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H24N2O2.C2H2O4/c1-15-7-9-16(10-8-15)12-20-19(22)14-21(2)13-17-5-4-6-18(11-17)23-3;3-1(4)2(5)6/h4-11H,12-14H2,1-3H3,(H,20,22);(H,3,4)(H,5,6) |
| InChIKey | BAJLELFDCVYEFZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|