C17H17ClN4O2S — CID 78815185
3-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 78815185) has the molecular formula C17H17ClN4O2S and a molecular weight of 376.87 g/mol. Its IUPAC name is 3-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 3-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 78815185 |
| Molecular Formula | C17H17ClN4O2S |
| Molecular Weight | 376.87 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 3-[(5-chloro-3-methyl-1-phenylpyrazol-4-yl)methyl]-7-thia-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | Cc1nn(-c2ccccc2)c(Cl)c1CN1C(=O)NC2(CCSC2)C1=O |
| InChI | InChI=1S/C17H17ClN4O2S/c1-11-13(14(18)22(20-11)12-5-3-2-4-6-12)9-21-15(23)17(19-16(21)24)7-8-25-10-17/h2-6H,7-10H2,1H3,(H,19,24) |
| InChIKey | TUWCLLKRERHPJU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.87 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|