C21H20F3N3O4 — CID 41129843
N-[(4R)-1-[(4-methoxyphenyl)methyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-phenylpropanamide (PubChem CID 41129843) has the molecular formula C21H20F3N3O4 and a molecular weight of 435.40 g/mol. Its IUPAC name is N-[(4R)-1-[(4-methoxyphenyl)methyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-phenylpropanamide.
| Compound Name | N-[(4R)-1-[(4-methoxyphenyl)methyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 41129843 |
| Molecular Formula | C21H20F3N3O4 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-[(4R)-1-[(4-methoxyphenyl)methyl]-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-3-phenylpropanamide |
| SMILES | COc1ccc(CN2C(=O)N[C@@](NC(=O)CCc3ccccc3)(C(F)(F)F)C2=O)cc1 |
| InChI | InChI=1S/C21H20F3N3O4/c1-31-16-10-7-15(8-11-16)13-27-18(29)20(21(22,23)24,26-19(27)30)25-17(28)12-9-14-5-3-2-4-6-14/h2-8,10-11H,9,12-13H2,1H3,(H,25,28)(H,26,30)/t20-/m1/s1 |
| InChIKey | PHLSDNWNSVMFRO-HXUWFJFHSA-N |
| XLogP | 2.75 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|