C15H11F3N4O3S — CID 2220199
N-[(4S)-2,5-dioxo-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)imidazolidin-4-yl]thiophene-2-carboxamide (PubChem CID 2220199) has the molecular formula C15H11F3N4O3S and a molecular weight of 384.34 g/mol. Its IUPAC name is N-[(4S)-2,5-dioxo-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)imidazolidin-4-yl]thiophene-2-carboxamide.
| Compound Name | N-[(4S)-2,5-dioxo-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)imidazolidin-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 2220199 |
| Molecular Formula | C15H11F3N4O3S |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | N-[(4S)-2,5-dioxo-1-(pyridin-3-ylmethyl)-4-(trifluoromethyl)imidazolidin-4-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@]1(C(F)(F)F)NC(=O)N(Cc2cccnc2)C1=O)c1cccs1 |
| InChI | InChI=1S/C15H11F3N4O3S/c16-15(17,18)14(20-11(23)10-4-2-6-26-10)12(24)22(13(25)21-14)8-9-3-1-5-19-7-9/h1-7H,8H2,(H,20,23)(H,21,25)/t14-/m0/s1 |
| InChIKey | YDOJTXAAUPLPGZ-AWEZNQCLSA-N |
| XLogP | 1.88 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|