C11H9F3N4O3 — CID 41062810
N-[(4S)-1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]pyridine-3-carboxamide (PubChem CID 41062810) has the molecular formula C11H9F3N4O3 and a molecular weight of 302.21 g/mol. Its IUPAC name is N-[(4S)-1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[(4S)-1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 41062810 |
| Molecular Formula | C11H9F3N4O3 |
| Molecular Weight | 302.21 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N-[(4S)-1-methyl-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]pyridine-3-carboxamide |
| SMILES | CN1C(=O)N[C@](NC(=O)c2cccnc2)(C(F)(F)F)C1=O |
| InChI | InChI=1S/C11H9F3N4O3/c1-18-8(20)10(11(12,13)14,17-9(18)21)16-7(19)6-3-2-4-15-5-6/h2-5H,1H3,(H,16,19)(H,17,21)/t10-/m0/s1 |
| InChIKey | SPTSORXTUBPCSI-JTQLQIEISA-N |
| XLogP | 0.25 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.21 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|