C25H29NO3 — CID 1255540
(3R)-3-[2-(4-tert-butyl-2,6-dimethylphenyl)-2-oxoethyl]-3-hydroxy-1-prop-2-enylindol-2-one (PubChem CID 1255540) has the molecular formula C25H29NO3 and a molecular weight of 391.51 g/mol. Its IUPAC name is (3R)-3-[2-(4-tert-butyl-2,6-dimethylphenyl)-2-oxoethyl]-3-hydroxy-1-prop-2-enylindol-2-one.
| Compound Name | (3R)-3-[2-(4-tert-butyl-2,6-dimethylphenyl)-2-oxoethyl]-3-hydroxy-1-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 1255540 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | (3R)-3-[2-(4-tert-butyl-2,6-dimethylphenyl)-2-oxoethyl]-3-hydroxy-1-prop-2-enylindol-2-one |
| SMILES | C=CCN1C(=O)[C@@](O)(CC(=O)c2c(C)cc(C(C)(C)C)cc2C)c2ccccc21 |
| InChI | InChI=1S/C25H29NO3/c1-7-12-26-20-11-9-8-10-19(20)25(29,23(26)28)15-21(27)22-16(2)13-18(14-17(22)3)24(4,5)6/h7-11,13-14,29H,1,12,15H2,2-6H3/t25-/m1/s1 |
| InChIKey | INLCQZBTAXBHKP-RUZDIDTESA-N |
| XLogP | 4.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|