C27H22BrNO5 — CID 3791148
3-[4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-5-bromo-3-hydroxy-1-(2-phenylethyl)indol-2-one (PubChem CID 3791148) has the molecular formula C27H22BrNO5 and a molecular weight of 520.38 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-5-bromo-3-hydroxy-1-(2-phenylethyl)indol-2-one.
| Compound Name | 3-[4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-5-bromo-3-hydroxy-1-(2-phenylethyl)indol-2-one |
|---|---|
| PubChem CID | 3791148 |
| Molecular Formula | C27H22BrNO5 |
| Molecular Weight | 520.38 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-5-bromo-3-hydroxy-1-(2-phenylethyl)indol-2-one |
| SMILES | O=C(C=Cc1ccc2c(c1)OCO2)CC1(O)C(=O)N(CCc2ccccc2)c2ccc(Br)cc21 |
| InChI | InChI=1S/C27H22BrNO5/c28-20-8-10-23-22(15-20)27(32,26(31)29(23)13-12-18-4-2-1-3-5-18)16-21(30)9-6-19-7-11-24-25(14-19)34-17-33-24/h1-11,14-15,32H,12-13,16-17H2 |
| InChIKey | CRZHNKMOFIUKGX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|