C23H21NO7 — CID 1331082
ethyl 2-[(3S)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-3-hydroxy-2-oxoindol-1-yl]acetate (PubChem CID 1331082) has the molecular formula C23H21NO7 and a molecular weight of 423.42 g/mol. Its IUPAC name is ethyl 2-[(3S)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-3-hydroxy-2-oxoindol-1-yl]acetate.
| Compound Name | ethyl 2-[(3S)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-3-hydroxy-2-oxoindol-1-yl]acetate |
|---|---|
| PubChem CID | 1331082 |
| Molecular Formula | C23H21NO7 |
| Molecular Weight | 423.42 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | ethyl 2-[(3S)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-3-hydroxy-2-oxoindol-1-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)[C@](O)(CC(=O)/C=C/c2ccc3c(c2)OCO3)c2ccccc21 |
| InChI | InChI=1S/C23H21NO7/c1-2-29-21(26)13-24-18-6-4-3-5-17(18)23(28,22(24)27)12-16(25)9-7-15-8-10-19-20(11-15)31-14-30-19/h3-11,28H,2,12-14H2,1H3/b9-7+/t23-/m0/s1 |
| InChIKey | HFEYANZCSPBNRM-WCYCAPIHSA-N |
| XLogP | 2.19 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|