C20H17NO5 — CID 3805692
3-[4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-3-hydroxy-5-methyl-1H-indol-2-one (PubChem CID 3805692) has the molecular formula C20H17NO5 and a molecular weight of 351.36 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-3-hydroxy-5-methyl-1H-indol-2-one.
| Compound Name | 3-[4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-3-hydroxy-5-methyl-1H-indol-2-one |
|---|---|
| PubChem CID | 3805692 |
| Molecular Formula | C20H17NO5 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-3-hydroxy-5-methyl-1H-indol-2-one |
| SMILES | Cc1ccc2c(c1)C(O)(CC(=O)C=Cc1ccc3c(c1)OCO3)C(=O)N2 |
| InChI | InChI=1S/C20H17NO5/c1-12-2-6-16-15(8-12)20(24,19(23)21-16)10-14(22)5-3-13-4-7-17-18(9-13)26-11-25-17/h2-9,24H,10-11H2,1H3,(H,21,23) |
| InChIKey | XHAFPHKTWHTOQO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|