C19H14ClNO5 — CID 1331137
(3S)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-5-chloro-3-hydroxy-1H-indol-2-one (PubChem CID 1331137) has the molecular formula C19H14ClNO5 and a molecular weight of 371.78 g/mol. Its IUPAC name is (3S)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-5-chloro-3-hydroxy-1H-indol-2-one.
| Compound Name | (3S)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-5-chloro-3-hydroxy-1H-indol-2-one |
|---|---|
| PubChem CID | 1331137 |
| Molecular Formula | C19H14ClNO5 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | (3S)-3-[(E)-4-(1,3-benzodioxol-5-yl)-2-oxobut-3-enyl]-5-chloro-3-hydroxy-1H-indol-2-one |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)C[C@@]1(O)C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C19H14ClNO5/c20-12-3-5-15-14(8-12)19(24,18(23)21-15)9-13(22)4-1-11-2-6-16-17(7-11)26-10-25-16/h1-8,24H,9-10H2,(H,21,23)/b4-1+/t19-/m0/s1 |
| InChIKey | IKDGZBPSXNMNSR-KIYPBCMGSA-N |
| XLogP | 2.88 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|