C24H29N2O3+ — CID 6985575
(3R)-3-[2-(4-ethylphenyl)-2-oxoethyl]-3-hydroxy-1-(piperidin-1-ium-1-ylmethyl)indol-2-one (PubChem CID 6985575) has the molecular formula C24H29N2O3+ and a molecular weight of 393.51 g/mol. Its IUPAC name is (3R)-3-[2-(4-ethylphenyl)-2-oxoethyl]-3-hydroxy-1-(piperidin-1-ium-1-ylmethyl)indol-2-one.
| Compound Name | (3R)-3-[2-(4-ethylphenyl)-2-oxoethyl]-3-hydroxy-1-(piperidin-1-ium-1-ylmethyl)indol-2-one |
|---|---|
| PubChem CID | 6985575 |
| Molecular Formula | C24H29N2O3+ |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | (3R)-3-[2-(4-ethylphenyl)-2-oxoethyl]-3-hydroxy-1-(piperidin-1-ium-1-ylmethyl)indol-2-one |
| SMILES | CCc1ccc(C(=O)C[C@]2(O)C(=O)N(C[NH+]3CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H28N2O3/c1-2-18-10-12-19(13-11-18)22(27)16-24(29)20-8-4-5-9-21(20)26(23(24)28)17-25-14-6-3-7-15-25/h4-5,8-13,29H,2-3,6-7,14-17H2,1H3/p+1/t24-/m1/s1 |
| InChIKey | ZHOSOIVHEYWFRQ-XMMPIXPASA-O |
| XLogP | 2.08 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |