C23H27NO4 — CID 41254743
(3R)-3-hydroxy-5,7-dimethyl-1-[3-(4-methylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one (PubChem CID 41254743) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (3R)-3-hydroxy-5,7-dimethyl-1-[3-(4-methylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one.
| Compound Name | (3R)-3-hydroxy-5,7-dimethyl-1-[3-(4-methylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one |
|---|---|
| PubChem CID | 41254743 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (3R)-3-hydroxy-5,7-dimethyl-1-[3-(4-methylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one |
| SMILES | CC(=O)C[C@]1(O)C(=O)N(CCCOc2ccc(C)cc2)c2c(C)cc(C)cc21 |
| InChI | InChI=1S/C23H27NO4/c1-15-6-8-19(9-7-15)28-11-5-10-24-21-17(3)12-16(2)13-20(21)23(27,22(24)26)14-18(4)25/h6-9,12-13,27H,5,10-11,14H2,1-4H3/t23-/m1/s1 |
| InChIKey | SIPVWLFYYRYKLA-HSZRJFAPSA-N |
| XLogP | 3.59 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|