C23H25Cl2NO4 — CID 18888654
6,7-dichloro-3-hydroxy-3-(2-oxopropyl)-1-[(2-pentoxyphenyl)methyl]indol-2-one (PubChem CID 18888654) has the molecular formula C23H25Cl2NO4 and a molecular weight of 450.36 g/mol. Its IUPAC name is 6,7-dichloro-3-hydroxy-3-(2-oxopropyl)-1-[(2-pentoxyphenyl)methyl]indol-2-one.
| Compound Name | 6,7-dichloro-3-hydroxy-3-(2-oxopropyl)-1-[(2-pentoxyphenyl)methyl]indol-2-one |
|---|---|
| PubChem CID | 18888654 |
| Molecular Formula | C23H25Cl2NO4 |
| Molecular Weight | 450.36 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 6,7-dichloro-3-hydroxy-3-(2-oxopropyl)-1-[(2-pentoxyphenyl)methyl]indol-2-one |
| SMILES | CCCCCOc1ccccc1CN1C(=O)C(O)(CC(C)=O)c2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C23H25Cl2NO4/c1-3-4-7-12-30-19-9-6-5-8-16(19)14-26-21-17(10-11-18(24)20(21)25)23(29,22(26)28)13-15(2)27/h5-6,8-11,29H,3-4,7,12-14H2,1-2H3 |
| InChIKey | AVSSGGOZWWHCRX-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.36 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|