C21H22ClNO4 — CID 18888558
7-chloro-3-hydroxy-1-[3-(2-methylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one (PubChem CID 18888558) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is 7-chloro-3-hydroxy-1-[3-(2-methylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one.
| Compound Name | 7-chloro-3-hydroxy-1-[3-(2-methylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one |
|---|---|
| PubChem CID | 18888558 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 7-chloro-3-hydroxy-1-[3-(2-methylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one |
| SMILES | CC(=O)CC1(O)C(=O)N(CCCOc2ccccc2C)c2c(Cl)cccc21 |
| InChI | InChI=1S/C21H22ClNO4/c1-14-7-3-4-10-18(14)27-12-6-11-23-19-16(8-5-9-17(19)22)21(26,20(23)25)13-15(2)24/h3-5,7-10,26H,6,11-13H2,1-2H3 |
| InChIKey | FFLAKXYVOQYCIV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|