C23H26ClNO4 — CID 18888556
7-chloro-3-hydroxy-1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]-3-(2-oxopropyl)indol-2-one (PubChem CID 18888556) has the molecular formula C23H26ClNO4 and a molecular weight of 415.92 g/mol. Its IUPAC name is 7-chloro-3-hydroxy-1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]-3-(2-oxopropyl)indol-2-one.
| Compound Name | 7-chloro-3-hydroxy-1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]-3-(2-oxopropyl)indol-2-one |
|---|---|
| PubChem CID | 18888556 |
| Molecular Formula | C23H26ClNO4 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 7-chloro-3-hydroxy-1-[2-(5-methyl-2-propan-2-ylphenoxy)ethyl]-3-(2-oxopropyl)indol-2-one |
| SMILES | CC(=O)CC1(O)C(=O)N(CCOc2cc(C)ccc2C(C)C)c2c(Cl)cccc21 |
| InChI | InChI=1S/C23H26ClNO4/c1-14(2)17-9-8-15(3)12-20(17)29-11-10-25-21-18(6-5-7-19(21)24)23(28,22(25)27)13-16(4)26/h5-9,12,14,28H,10-11,13H2,1-4H3 |
| InChIKey | ANYJEIHQXMSNSD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |