C24H29NO4 — CID 7444599
(3R)-3-hydroxy-1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one (PubChem CID 7444599) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is (3R)-3-hydroxy-1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one.
| Compound Name | (3R)-3-hydroxy-1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one |
|---|---|
| PubChem CID | 7444599 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | (3R)-3-hydroxy-1-[3-(5-methyl-2-propan-2-ylphenoxy)propyl]-3-(2-oxopropyl)indol-2-one |
| SMILES | CC(=O)C[C@]1(O)C(=O)N(CCCOc2cc(C)ccc2C(C)C)c2ccccc21 |
| InChI | InChI=1S/C24H29NO4/c1-16(2)19-11-10-17(3)14-22(19)29-13-7-12-25-21-9-6-5-8-20(21)24(28,23(25)27)15-18(4)26/h5-6,8-11,14,16,28H,7,12-13,15H2,1-4H3/t24-/m1/s1 |
| InChIKey | KVQFTENMLNDFIV-XMMPIXPASA-N |
| XLogP | 4.10 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|