C15H17NO2 — CID 132572570
3-(hydroxymethyl)-1,3-bis(prop-2-enyl)indol-2-one (PubChem CID 132572570) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1,3-bis(prop-2-enyl)indol-2-one.
| Compound Name | 3-(hydroxymethyl)-1,3-bis(prop-2-enyl)indol-2-one |
|---|---|
| PubChem CID | 132572570 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | 3-(hydroxymethyl)-1,3-bis(prop-2-enyl)indol-2-one |
| SMILES | C=CCN1C(=O)C(CO)(CC=C)c2ccccc21 |
| InChI | InChI=1S/C15H17NO2/c1-3-9-15(11-17)12-7-5-6-8-13(12)16(10-4-2)14(15)18/h3-8,17H,1-2,9-11H2 |
| InChIKey | ISJMTJYBQUIHED-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|