C20H20N2O2 — CID 11359113
3-benzyl-1'-prop-2-enylspiro[1,3-oxazolidine-5,3'-indole]-2'-one (PubChem CID 11359113) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is 3-benzyl-1'-prop-2-enylspiro[1,3-oxazolidine-5,3'-indole]-2'-one.
| Compound Name | 3-benzyl-1'-prop-2-enylspiro[1,3-oxazolidine-5,3'-indole]-2'-one |
|---|---|
| PubChem CID | 11359113 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 3-benzyl-1'-prop-2-enylspiro[1,3-oxazolidine-5,3'-indole]-2'-one |
| SMILES | C=CCN1C(=O)C2(CN(Cc3ccccc3)CO2)c2ccccc21 |
| InChI | InChI=1S/C20H20N2O2/c1-2-12-22-18-11-7-6-10-17(18)20(19(22)23)14-21(15-24-20)13-16-8-4-3-5-9-16/h2-11H,1,12-15H2 |
| InChIKey | BRALENFLHGUUIO-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|