C29H29NO2 — CID 164667931
3-benzoyl-1-benzyl-5-tert-butyl-3-prop-2-enylindol-2-one (PubChem CID 164667931) has the molecular formula C29H29NO2 and a molecular weight of 423.56 g/mol. Its IUPAC name is 3-benzoyl-1-benzyl-5-tert-butyl-3-prop-2-enylindol-2-one.
| Compound Name | 3-benzoyl-1-benzyl-5-tert-butyl-3-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 164667931 |
| Molecular Formula | C29H29NO2 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 3-benzoyl-1-benzyl-5-tert-butyl-3-prop-2-enylindol-2-one |
| SMILES | C=CCC1(C(=O)c2ccccc2)C(=O)N(Cc2ccccc2)c2ccc(C(C)(C)C)cc21 |
| InChI | InChI=1S/C29H29NO2/c1-5-18-29(26(31)22-14-10-7-11-15-22)24-19-23(28(2,3)4)16-17-25(24)30(27(29)32)20-21-12-8-6-9-13-21/h5-17,19H,1,18,20H2,2-4H3 |
| InChIKey | SHROWFOFSHMGTD-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|