C22H25NO2 — CID 139255179
3-(5-tert-butyl-2-hydroxyphenyl)-1-methyl-3-prop-2-enylindol-2-one (PubChem CID 139255179) has the molecular formula C22H25NO2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 3-(5-tert-butyl-2-hydroxyphenyl)-1-methyl-3-prop-2-enylindol-2-one.
| Compound Name | 3-(5-tert-butyl-2-hydroxyphenyl)-1-methyl-3-prop-2-enylindol-2-one |
|---|---|
| PubChem CID | 139255179 |
| Molecular Formula | C22H25NO2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | 3-(5-tert-butyl-2-hydroxyphenyl)-1-methyl-3-prop-2-enylindol-2-one |
| SMILES | C=CCC1(c2cc(C(C)(C)C)ccc2O)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C22H25NO2/c1-6-13-22(16-9-7-8-10-18(16)23(5)20(22)25)17-14-15(21(2,3)4)11-12-19(17)24/h6-12,14,24H,1,13H2,2-5H3 |
| InChIKey | FRMTWZNVBQWECN-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|