C14H14F3NO2 — CID 139193545
(3R)-1-methyl-3-prop-2-enyl-3-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]indol-2-one (PubChem CID 139193545) has the molecular formula C14H14F3NO2 and a molecular weight of 285.27 g/mol. Its IUPAC name is (3R)-1-methyl-3-prop-2-enyl-3-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]indol-2-one.
| Compound Name | (3R)-1-methyl-3-prop-2-enyl-3-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]indol-2-one |
|---|---|
| PubChem CID | 139193545 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | (3R)-1-methyl-3-prop-2-enyl-3-[(1S)-2,2,2-trifluoro-1-hydroxyethyl]indol-2-one |
| SMILES | C=CC[C@@]1([C@H](O)C(F)(F)F)C(=O)N(C)c2ccccc21 |
| InChI | InChI=1S/C14H14F3NO2/c1-3-8-13(11(19)14(15,16)17)9-6-4-5-7-10(9)18(2)12(13)20/h3-7,11,19H,1,8H2,2H3/t11-,13+/m0/s1 |
| InChIKey | KVBMHZJXKONCBC-WCQYABFASA-N |
| XLogP | 2.40 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|